C13H17NO3S2 — CID 78980678
2-[1-(2-thiophen-2-ylsulfanylacetyl)piperidin-4-yl]acetic acid (PubChem CID 78980678) has the molecular formula C13H17NO3S2 and a molecular weight of 299.42 g/mol. Its IUPAC name is 2-[1-(2-thiophen-2-ylsulfanylacetyl)piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-(2-thiophen-2-ylsulfanylacetyl)piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 78980678 |
| Molecular Formula | C13H17NO3S2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 2-[1-(2-thiophen-2-ylsulfanylacetyl)piperidin-4-yl]acetic acid |
| SMILES | O=C(O)CC1CCN(C(=O)CSc2cccs2)CC1 |
| InChI | InChI=1S/C13H17NO3S2/c15-11(9-19-13-2-1-7-18-13)14-5-3-10(4-6-14)8-12(16)17/h1-2,7,10H,3-6,8-9H2,(H,16,17) |
| InChIKey | JRVYQZJNIQZWEX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |