C12H15NO4S2 — CID 78926910
methyl 4-(2-thiophen-2-ylsulfanylacetyl)morpholine-2-carboxylate (PubChem CID 78926910) has the molecular formula C12H15NO4S2 and a molecular weight of 301.39 g/mol. Its IUPAC name is methyl 4-(2-thiophen-2-ylsulfanylacetyl)morpholine-2-carboxylate.
| Compound Name | methyl 4-(2-thiophen-2-ylsulfanylacetyl)morpholine-2-carboxylate |
|---|---|
| PubChem CID | 78926910 |
| Molecular Formula | C12H15NO4S2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | methyl 4-(2-thiophen-2-ylsulfanylacetyl)morpholine-2-carboxylate |
| SMILES | COC(=O)C1CN(C(=O)CSc2cccs2)CCO1 |
| InChI | InChI=1S/C12H15NO4S2/c1-16-12(15)9-7-13(4-5-17-9)10(14)8-19-11-3-2-6-18-11/h2-3,6,9H,4-5,7-8H2,1H3 |
| InChIKey | NDEKUUZNNHSTOL-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |