C13H17NO3S2 — CID 78986623
methyl 1-(2-thiophen-2-ylsulfanylacetyl)piperidine-2-carboxylate (PubChem CID 78986623) has the molecular formula C13H17NO3S2 and a molecular weight of 299.42 g/mol. Its IUPAC name is methyl 1-(2-thiophen-2-ylsulfanylacetyl)piperidine-2-carboxylate.
| Compound Name | methyl 1-(2-thiophen-2-ylsulfanylacetyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 78986623 |
| Molecular Formula | C13H17NO3S2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | methyl 1-(2-thiophen-2-ylsulfanylacetyl)piperidine-2-carboxylate |
| SMILES | COC(=O)C1CCCCN1C(=O)CSc1cccs1 |
| InChI | InChI=1S/C13H17NO3S2/c1-17-13(16)10-5-2-3-7-14(10)11(15)9-19-12-6-4-8-18-12/h4,6,8,10H,2-3,5,7,9H2,1H3 |
| InChIKey | KVXPZFPYOVDYFO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |