C13H16N2O5S — CID 78927122
methyl 4-[2-(thiophene-2-carbonylamino)acetyl]morpholine-2-carboxylate (PubChem CID 78927122) has the molecular formula C13H16N2O5S and a molecular weight of 312.35 g/mol. Its IUPAC name is methyl 4-[2-(thiophene-2-carbonylamino)acetyl]morpholine-2-carboxylate.
| Compound Name | methyl 4-[2-(thiophene-2-carbonylamino)acetyl]morpholine-2-carboxylate |
|---|---|
| PubChem CID | 78927122 |
| Molecular Formula | C13H16N2O5S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | methyl 4-[2-(thiophene-2-carbonylamino)acetyl]morpholine-2-carboxylate |
| SMILES | COC(=O)C1CN(C(=O)CNC(=O)c2cccs2)CCO1 |
| InChI | InChI=1S/C13H16N2O5S/c1-19-13(18)9-8-15(4-5-20-9)11(16)7-14-12(17)10-3-2-6-21-10/h2-3,6,9H,4-5,7-8H2,1H3,(H,14,17) |
| InChIKey | QYKGPFDBSWTWAX-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |