C12H13N3S2 — CID 113388628
N-[(2-thiophen-2-ylsulfanylpyrimidin-5-yl)methyl]cyclopropanamine (PubChem CID 113388628) has the molecular formula C12H13N3S2 and a molecular weight of 263.39 g/mol. Its IUPAC name is N-[(2-thiophen-2-ylsulfanylpyrimidin-5-yl)methyl]cyclopropanamine.
| Compound Name | N-[(2-thiophen-2-ylsulfanylpyrimidin-5-yl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 113388628 |
| Molecular Formula | C12H13N3S2 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | N-[(2-thiophen-2-ylsulfanylpyrimidin-5-yl)methyl]cyclopropanamine |
| SMILES | c1csc(Sc2ncc(CNC3CC3)cn2)c1 |
| InChI | InChI=1S/C12H13N3S2/c1-2-11(16-5-1)17-12-14-7-9(8-15-12)6-13-10-3-4-10/h1-2,5,7-8,10,13H,3-4,6H2 |
| InChIKey | IUITUNIIECMKIC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |