C13H21NS2 — CID 62577729
4-methyl-N-(2-thiophen-2-ylsulfanylethyl)cyclohexan-1-amine (PubChem CID 62577729) has the molecular formula C13H21NS2 and a molecular weight of 255.45 g/mol. Its IUPAC name is 4-methyl-N-(2-thiophen-2-ylsulfanylethyl)cyclohexan-1-amine.
| Compound Name | 4-methyl-N-(2-thiophen-2-ylsulfanylethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 62577729 |
| Molecular Formula | C13H21NS2 |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 4-methyl-N-(2-thiophen-2-ylsulfanylethyl)cyclohexan-1-amine |
| SMILES | CC1CCC(NCCSc2cccs2)CC1 |
| InChI | InChI=1S/C13H21NS2/c1-11-4-6-12(7-5-11)14-8-10-16-13-3-2-9-15-13/h2-3,9,11-12,14H,4-8,10H2,1H3 |
| InChIKey | KGVHTXQINIDSJN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|