C11H15NO2S2 — CID 63034813
2-(cyclopropylamino)-4-thiophen-2-ylsulfanylbutanoic acid (PubChem CID 63034813) has the molecular formula C11H15NO2S2 and a molecular weight of 257.38 g/mol. Its IUPAC name is 2-(cyclopropylamino)-4-thiophen-2-ylsulfanylbutanoic acid.
| Compound Name | 2-(cyclopropylamino)-4-thiophen-2-ylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 63034813 |
| Molecular Formula | C11H15NO2S2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 2-(cyclopropylamino)-4-thiophen-2-ylsulfanylbutanoic acid |
| SMILES | O=C(O)C(CCSc1cccs1)NC1CC1 |
| InChI | InChI=1S/C11H15NO2S2/c13-11(14)9(12-8-3-4-8)5-7-16-10-2-1-6-15-10/h1-2,6,8-9,12H,3-5,7H2,(H,13,14) |
| InChIKey | DVODNVQHJFFWMK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |