C17H25NO2S — CID 63033254
4-(4-tert-butylphenyl)sulfanyl-2-(cyclopropylamino)butanoic acid (PubChem CID 63033254) has the molecular formula C17H25NO2S and a molecular weight of 307.46 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)sulfanyl-2-(cyclopropylamino)butanoic acid.
| Compound Name | 4-(4-tert-butylphenyl)sulfanyl-2-(cyclopropylamino)butanoic acid |
|---|---|
| PubChem CID | 63033254 |
| Molecular Formula | C17H25NO2S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 4-(4-tert-butylphenyl)sulfanyl-2-(cyclopropylamino)butanoic acid |
| SMILES | CC(C)(C)c1ccc(SCCC(NC2CC2)C(=O)O)cc1 |
| InChI | InChI=1S/C17H25NO2S/c1-17(2,3)12-4-8-14(9-5-12)21-11-10-15(16(19)20)18-13-6-7-13/h4-5,8-9,13,15,18H,6-7,10-11H2,1-3H3,(H,19,20) |
| InChIKey | MGGNTNVDMZCWHO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |