C15H19N3O2S — CID 63033824
2-(cyclopropylamino)-4-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]butanoic acid (PubChem CID 63033824) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 2-(cyclopropylamino)-4-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]butanoic acid.
| Compound Name | 2-(cyclopropylamino)-4-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]butanoic acid |
|---|---|
| PubChem CID | 63033824 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-(cyclopropylamino)-4-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]butanoic acid |
| SMILES | Cc1ccc2nc(SCCC(NC3CC3)C(=O)O)[nH]c2c1 |
| InChI | InChI=1S/C15H19N3O2S/c1-9-2-5-11-13(8-9)18-15(17-11)21-7-6-12(14(19)20)16-10-3-4-10/h2,5,8,10,12,16H,3-4,6-7H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | QZGQJCKGSRKTDF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |