C8H11NO2S2 — CID 69098628
(2R)-2-(methylamino)-3-thiophen-2-ylsulfanylpropanoic acid (PubChem CID 69098628) has the molecular formula C8H11NO2S2 and a molecular weight of 217.31 g/mol. Its IUPAC name is (2R)-2-(methylamino)-3-thiophen-2-ylsulfanylpropanoic acid.
| Compound Name | (2R)-2-(methylamino)-3-thiophen-2-ylsulfanylpropanoic acid |
|---|---|
| PubChem CID | 69098628 |
| Molecular Formula | C8H11NO2S2 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.02 |
| IUPAC Name | (2R)-2-(methylamino)-3-thiophen-2-ylsulfanylpropanoic acid |
| SMILES | CN[C@@H](CSc1cccs1)C(=O)O |
| InChI | InChI=1S/C8H11NO2S2/c1-9-6(8(10)11)5-13-7-3-2-4-12-7/h2-4,6,9H,5H2,1H3,(H,10,11)/t6-/m0/s1 |
| InChIKey | IFLJSUCSAHERDF-LURJTMIESA-N |
| XLogP | 1.51 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |