C10H15N3S2 — CID 103068689
N-[2-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanylmethyl]prop-2-enyl]cyclopropanamine (PubChem CID 103068689) has the molecular formula C10H15N3S2 and a molecular weight of 241.38 g/mol. Its IUPAC name is N-[2-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanylmethyl]prop-2-enyl]cyclopropanamine.
| Compound Name | N-[2-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanylmethyl]prop-2-enyl]cyclopropanamine |
|---|---|
| PubChem CID | 103068689 |
| Molecular Formula | C10H15N3S2 |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | N-[2-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanylmethyl]prop-2-enyl]cyclopropanamine |
| SMILES | C=C(CNC1CC1)CSc1nc(C)ns1 |
| InChI | InChI=1S/C10H15N3S2/c1-7(5-11-9-3-4-9)6-14-10-12-8(2)13-15-10/h9,11H,1,3-6H2,2H3 |
| InChIKey | XPKYNVYHFDCBDU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|