C12H18N2OS — CID 103072428
3-[2-[(cyclopropylamino)methyl]prop-2-enyl]-4,5-dimethyl-1,3-thiazol-2-one (PubChem CID 103072428) has the molecular formula C12H18N2OS and a molecular weight of 238.36 g/mol. Its IUPAC name is 3-[2-[(cyclopropylamino)methyl]prop-2-enyl]-4,5-dimethyl-1,3-thiazol-2-one.
| Compound Name | 3-[2-[(cyclopropylamino)methyl]prop-2-enyl]-4,5-dimethyl-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 103072428 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 3-[2-[(cyclopropylamino)methyl]prop-2-enyl]-4,5-dimethyl-1,3-thiazol-2-one |
| SMILES | C=C(CNC1CC1)Cn1c(C)c(C)sc1=O |
| InChI | InChI=1S/C12H18N2OS/c1-8(6-13-11-4-5-11)7-14-9(2)10(3)16-12(14)15/h11,13H,1,4-7H2,2-3H3 |
| InChIKey | LCOWIFLMZIHXBQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|