C9H12ClNOS — CID 103065782
3-[2-(chloromethyl)prop-2-enyl]-4,5-dimethyl-1,3-thiazol-2-one (PubChem CID 103065782) has the molecular formula C9H12ClNOS and a molecular weight of 217.72 g/mol. Its IUPAC name is 3-[2-(chloromethyl)prop-2-enyl]-4,5-dimethyl-1,3-thiazol-2-one.
| Compound Name | 3-[2-(chloromethyl)prop-2-enyl]-4,5-dimethyl-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 103065782 |
| Molecular Formula | C9H12ClNOS |
| Molecular Weight | 217.72 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | 3-[2-(chloromethyl)prop-2-enyl]-4,5-dimethyl-1,3-thiazol-2-one |
| SMILES | C=C(CCl)Cn1c(C)c(C)sc1=O |
| InChI | InChI=1S/C9H12ClNOS/c1-6(4-10)5-11-7(2)8(3)13-9(11)12/h1,4-5H2,2-3H3 |
| InChIKey | JHQKFBYVUNWWSA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.72 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|