About 4,5-dimethyl-3-(2-methylprop-2-enyl)-1,3-thiazol-2-one
4,5-dimethyl-3-(2-methylprop-2-enyl)-1,3-thiazol-2-one (PubChem CID 130652038) has the molecular formula C9H13NOS
and a molecular weight of 183.28 g/mol. Its IUPAC name is 4,5-dimethyl-3-(2-methylprop-2-enyl)-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 4,5-dimethyl-3-(2-methylprop-2-enyl)-1,3-thiazol-2-one |
| PubChem CID | 130652038 |
| Molecular Formula | C9H13NOS |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | 4,5-dimethyl-3-(2-methylprop-2-enyl)-1,3-thiazol-2-one |
| SMILES | C=C(C)Cn1c(C)c(C)sc1=O |
| InChI | InChI=1S/C9H13NOS/c1-6(2)5-10-7(3)8(4)12-9(10)11/h1,5H2,2-4H3 |
| InChIKey | UPQBLWLXAZUMTC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dimethyl-3-(2-methylprop-2-enyl)-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-3-(2-methylprop-2-enyl)-1,3-thiazol-2-one?
The IUPAC name of 4,5-dimethyl-3-(2-methylprop-2-enyl)-1,3-thiazol-2-one (CID 130652038) is 4,5-dimethyl-3-(2-methylprop-2-enyl)-1,3-thiazol-2-one.
What is the SMILES notation for 4,5-dimethyl-3-(2-methylprop-2-enyl)-1,3-thiazol-2-one?
The canonical SMILES for 4,5-dimethyl-3-(2-methylprop-2-enyl)-1,3-thiazol-2-one is C=C(C)Cn1c(C)c(C)sc1=O.
What is the InChIKey of 4,5-dimethyl-3-(2-methylprop-2-enyl)-1,3-thiazol-2-one?
The InChIKey is UPQBLWLXAZUMTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NOS/c1-6(2)5-10-7(3)8(4)12-9(10)11/h1,5H2,2-4H3.
What are the key properties of 4,5-dimethyl-3-(2-methylprop-2-enyl)-1,3-thiazol-2-one?
4,5-dimethyl-3-(2-methylprop-2-enyl)-1,3-thiazol-2-one has a molecular weight of 183.28 g/mol, XLogP of 2.10, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-3-(2-methylprop-2-enyl)-1,3-thiazol-2-one is sourced from PubChem (CID 130652038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).