C9H13NOS2 — CID 103073975
4,5-dimethyl-3-[2-(sulfanylmethyl)prop-2-enyl]-1,3-thiazol-2-one (PubChem CID 103073975) has the molecular formula C9H13NOS2 and a molecular weight of 215.34 g/mol. Its IUPAC name is 4,5-dimethyl-3-[2-(sulfanylmethyl)prop-2-enyl]-1,3-thiazol-2-one.
| Compound Name | 4,5-dimethyl-3-[2-(sulfanylmethyl)prop-2-enyl]-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 103073975 |
| Molecular Formula | C9H13NOS2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | 4,5-dimethyl-3-[2-(sulfanylmethyl)prop-2-enyl]-1,3-thiazol-2-one |
| SMILES | C=C(CS)Cn1c(C)c(C)sc1=O |
| InChI | InChI=1S/C9H13NOS2/c1-6(5-12)4-10-7(2)8(3)13-9(10)11/h12H,1,4-5H2,2-3H3 |
| InChIKey | LAURITIXODCCPN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 22.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|