C8H12ClNOS — CID 63312859
3-(3-chloropropyl)-4,5-dimethyl-1,3-thiazol-2-one (PubChem CID 63312859) has the molecular formula C8H12ClNOS and a molecular weight of 205.71 g/mol. Its IUPAC name is 3-(3-chloropropyl)-4,5-dimethyl-1,3-thiazol-2-one.
| Compound Name | 3-(3-chloropropyl)-4,5-dimethyl-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 63312859 |
| Molecular Formula | C8H12ClNOS |
| Molecular Weight | 205.71 g/mol |
| Exact Mass | 205.03 |
| IUPAC Name | 3-(3-chloropropyl)-4,5-dimethyl-1,3-thiazol-2-one |
| SMILES | Cc1sc(=O)n(CCCCl)c1C |
| InChI | InChI=1S/C8H12ClNOS/c1-6-7(2)12-8(11)10(6)5-3-4-9/h3-5H2,1-2H3 |
| InChIKey | GBMFOYUDPPDSFM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.71 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|