C14H16N2OS — CID 103072901
5-[2-[(cyclopropylamino)methyl]prop-2-enyl]thieno[3,2-c]pyridin-4-one (PubChem CID 103072901) has the molecular formula C14H16N2OS and a molecular weight of 260.36 g/mol. Its IUPAC name is 5-[2-[(cyclopropylamino)methyl]prop-2-enyl]thieno[3,2-c]pyridin-4-one.
| Compound Name | 5-[2-[(cyclopropylamino)methyl]prop-2-enyl]thieno[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 103072901 |
| Molecular Formula | C14H16N2OS |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 5-[2-[(cyclopropylamino)methyl]prop-2-enyl]thieno[3,2-c]pyridin-4-one |
| SMILES | C=C(CNC1CC1)Cn1ccc2sccc2c1=O |
| InChI | InChI=1S/C14H16N2OS/c1-10(8-15-11-2-3-11)9-16-6-4-13-12(14(16)17)5-7-18-13/h4-7,11,15H,1-3,8-9H2 |
| InChIKey | ALFGVJGTNAEHFQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|