C16H22N2OS — CID 115912101
5-[2-(cycloheptylamino)ethyl]thieno[3,2-c]pyridin-4-one (PubChem CID 115912101) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is 5-[2-(cycloheptylamino)ethyl]thieno[3,2-c]pyridin-4-one.
| Compound Name | 5-[2-(cycloheptylamino)ethyl]thieno[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 115912101 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 5-[2-(cycloheptylamino)ethyl]thieno[3,2-c]pyridin-4-one |
| SMILES | O=c1c2ccsc2ccn1CCNC1CCCCCC1 |
| InChI | InChI=1S/C16H22N2OS/c19-16-14-8-12-20-15(14)7-10-18(16)11-9-17-13-5-3-1-2-4-6-13/h7-8,10,12-13,17H,1-6,9,11H2 |
| InChIKey | KLBSQYVIZBQKAQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |