C15H17NO2S — CID 103985823
5-(2-cyclohexyl-2-oxoethyl)thieno[3,2-c]pyridin-4-one (PubChem CID 103985823) has the molecular formula C15H17NO2S and a molecular weight of 275.37 g/mol. Its IUPAC name is 5-(2-cyclohexyl-2-oxoethyl)thieno[3,2-c]pyridin-4-one.
| Compound Name | 5-(2-cyclohexyl-2-oxoethyl)thieno[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 103985823 |
| Molecular Formula | C15H17NO2S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 5-(2-cyclohexyl-2-oxoethyl)thieno[3,2-c]pyridin-4-one |
| SMILES | O=C(Cn1ccc2sccc2c1=O)C1CCCCC1 |
| InChI | InChI=1S/C15H17NO2S/c17-13(11-4-2-1-3-5-11)10-16-8-6-14-12(15(16)18)7-9-19-14/h6-9,11H,1-5,10H2 |
| InChIKey | STYPEROZRYBKRU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |