C14H27N3 — CID 103071089
N-methyl-2-[(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methyl]prop-2-en-1-amine (PubChem CID 103071089) has the molecular formula C14H27N3 and a molecular weight of 237.39 g/mol. Its IUPAC name is N-methyl-2-[(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methyl]prop-2-en-1-amine.
| Compound Name | N-methyl-2-[(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 103071089 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | N-methyl-2-[(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methyl]prop-2-en-1-amine |
| SMILES | C=C(CNC)CN1CCC2C(CCCN2C)C1 |
| InChI | InChI=1S/C14H27N3/c1-12(9-15-2)10-17-8-6-14-13(11-17)5-4-7-16(14)3/h13-15H,1,4-11H2,2-3H3 |
| InChIKey | CNRURHXOGVMFAX-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|