C11H24N2O2 — CID 103071268
2-[2-(ethylaminomethyl)prop-2-enyl-(2-methoxyethyl)amino]ethanol (PubChem CID 103071268) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is 2-[2-(ethylaminomethyl)prop-2-enyl-(2-methoxyethyl)amino]ethanol.
| Compound Name | 2-[2-(ethylaminomethyl)prop-2-enyl-(2-methoxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 103071268 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 2-[2-(ethylaminomethyl)prop-2-enyl-(2-methoxyethyl)amino]ethanol |
| SMILES | C=C(CNCC)CN(CCO)CCOC |
| InChI | InChI=1S/C11H24N2O2/c1-4-12-9-11(2)10-13(5-7-14)6-8-15-3/h12,14H,2,4-10H2,1,3H3 |
| InChIKey | YGJCHJQPKSPUMF-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|