C10H20F2N2O — CID 107484785
2-[2,2-difluoroethyl-[2-(ethylaminomethyl)prop-2-enyl]amino]ethanol (PubChem CID 107484785) has the molecular formula C10H20F2N2O and a molecular weight of 222.28 g/mol. Its IUPAC name is 2-[2,2-difluoroethyl-[2-(ethylaminomethyl)prop-2-enyl]amino]ethanol.
| Compound Name | 2-[2,2-difluoroethyl-[2-(ethylaminomethyl)prop-2-enyl]amino]ethanol |
|---|---|
| PubChem CID | 107484785 |
| Molecular Formula | C10H20F2N2O |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 2-[2,2-difluoroethyl-[2-(ethylaminomethyl)prop-2-enyl]amino]ethanol |
| SMILES | C=C(CNCC)CN(CCO)CC(F)F |
| InChI | InChI=1S/C10H20F2N2O/c1-3-13-6-9(2)7-14(4-5-15)8-10(11)12/h10,13,15H,2-8H2,1H3 |
| InChIKey | FDQIKVXBCUXQHJ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|