C9H18F2N2O — CID 107484778
2-[2,2-difluoroethyl-[2-(methylaminomethyl)prop-2-enyl]amino]ethanol (PubChem CID 107484778) has the molecular formula C9H18F2N2O and a molecular weight of 208.25 g/mol. Its IUPAC name is 2-[2,2-difluoroethyl-[2-(methylaminomethyl)prop-2-enyl]amino]ethanol.
| Compound Name | 2-[2,2-difluoroethyl-[2-(methylaminomethyl)prop-2-enyl]amino]ethanol |
|---|---|
| PubChem CID | 107484778 |
| Molecular Formula | C9H18F2N2O |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | 2-[2,2-difluoroethyl-[2-(methylaminomethyl)prop-2-enyl]amino]ethanol |
| SMILES | C=C(CNC)CN(CCO)CC(F)F |
| InChI | InChI=1S/C9H18F2N2O/c1-8(5-12-2)6-13(3-4-14)7-9(10)11/h9,12,14H,1,3-7H2,2H3 |
| InChIKey | IFYYUUPUMGISNQ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|