C12H24F2N2O — CID 107484771
2-[2-[(tert-butylamino)methyl]prop-2-enyl-(2,2-difluoroethyl)amino]ethanol (PubChem CID 107484771) has the molecular formula C12H24F2N2O and a molecular weight of 250.33 g/mol. Its IUPAC name is 2-[2-[(tert-butylamino)methyl]prop-2-enyl-(2,2-difluoroethyl)amino]ethanol.
| Compound Name | 2-[2-[(tert-butylamino)methyl]prop-2-enyl-(2,2-difluoroethyl)amino]ethanol |
|---|---|
| PubChem CID | 107484771 |
| Molecular Formula | C12H24F2N2O |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 2-[2-[(tert-butylamino)methyl]prop-2-enyl-(2,2-difluoroethyl)amino]ethanol |
| SMILES | C=C(CNC(C)(C)C)CN(CCO)CC(F)F |
| InChI | InChI=1S/C12H24F2N2O/c1-10(7-15-12(2,3)4)8-16(5-6-17)9-11(13)14/h11,15,17H,1,5-9H2,2-4H3 |
| InChIKey | KKHLUTYFWKBJFS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|