C11H22F2N2O — CID 107484777
2-[2,2-difluoroethyl-[2-[(propan-2-ylamino)methyl]prop-2-enyl]amino]ethanol (PubChem CID 107484777) has the molecular formula C11H22F2N2O and a molecular weight of 236.31 g/mol. Its IUPAC name is 2-[2,2-difluoroethyl-[2-[(propan-2-ylamino)methyl]prop-2-enyl]amino]ethanol.
| Compound Name | 2-[2,2-difluoroethyl-[2-[(propan-2-ylamino)methyl]prop-2-enyl]amino]ethanol |
|---|---|
| PubChem CID | 107484777 |
| Molecular Formula | C11H22F2N2O |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | 2-[2,2-difluoroethyl-[2-[(propan-2-ylamino)methyl]prop-2-enyl]amino]ethanol |
| SMILES | C=C(CNC(C)C)CN(CCO)CC(F)F |
| InChI | InChI=1S/C11H22F2N2O/c1-9(2)14-6-10(3)7-15(4-5-16)8-11(12)13/h9,11,14,16H,3-8H2,1-2H3 |
| InChIKey | SFJSGEVCXSORKW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|