C11H20F2N2O — CID 107484783
2-[2-[(cyclopropylamino)methyl]prop-2-enyl-(2,2-difluoroethyl)amino]ethanol (PubChem CID 107484783) has the molecular formula C11H20F2N2O and a molecular weight of 234.29 g/mol. Its IUPAC name is 2-[2-[(cyclopropylamino)methyl]prop-2-enyl-(2,2-difluoroethyl)amino]ethanol.
| Compound Name | 2-[2-[(cyclopropylamino)methyl]prop-2-enyl-(2,2-difluoroethyl)amino]ethanol |
|---|---|
| PubChem CID | 107484783 |
| Molecular Formula | C11H20F2N2O |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 2-[2-[(cyclopropylamino)methyl]prop-2-enyl-(2,2-difluoroethyl)amino]ethanol |
| SMILES | C=C(CNC1CC1)CN(CCO)CC(F)F |
| InChI | InChI=1S/C11H20F2N2O/c1-9(6-14-10-2-3-10)7-15(4-5-16)8-11(12)13/h10-11,14,16H,1-8H2 |
| InChIKey | ZZYBXTZNYYUBON-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|