C11H19F3N2O — CID 107484806
2-[2-[(cyclopropylamino)methyl]prop-2-enyl-(2,2,2-trifluoroethyl)amino]ethanol (PubChem CID 107484806) has the molecular formula C11H19F3N2O and a molecular weight of 252.28 g/mol. Its IUPAC name is 2-[2-[(cyclopropylamino)methyl]prop-2-enyl-(2,2,2-trifluoroethyl)amino]ethanol.
| Compound Name | 2-[2-[(cyclopropylamino)methyl]prop-2-enyl-(2,2,2-trifluoroethyl)amino]ethanol |
|---|---|
| PubChem CID | 107484806 |
| Molecular Formula | C11H19F3N2O |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-[2-[(cyclopropylamino)methyl]prop-2-enyl-(2,2,2-trifluoroethyl)amino]ethanol |
| SMILES | C=C(CNC1CC1)CN(CCO)CC(F)(F)F |
| InChI | InChI=1S/C11H19F3N2O/c1-9(6-15-10-2-3-10)7-16(4-5-17)8-11(12,13)14/h10,15,17H,1-8H2 |
| InChIKey | ZOXIMEJZPXCSSB-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|