C13H28N2S — CID 103071342
N-methyl-2-methylidene-N-(4-methylsulfanylbutan-2-yl)-N'-propan-2-ylpropane-1,3-diamine (PubChem CID 103071342) has the molecular formula C13H28N2S and a molecular weight of 244.45 g/mol. Its IUPAC name is N-methyl-2-methylidene-N-(4-methylsulfanylbutan-2-yl)-N'-propan-2-ylpropane-1,3-diamine.
| Compound Name | N-methyl-2-methylidene-N-(4-methylsulfanylbutan-2-yl)-N'-propan-2-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 103071342 |
| Molecular Formula | C13H28N2S |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | N-methyl-2-methylidene-N-(4-methylsulfanylbutan-2-yl)-N'-propan-2-ylpropane-1,3-diamine |
| SMILES | C=C(CNC(C)C)CN(C)C(C)CCSC |
| InChI | InChI=1S/C13H28N2S/c1-11(2)14-9-12(3)10-15(5)13(4)7-8-16-6/h11,13-14H,3,7-10H2,1-2,4-6H3 |
| InChIKey | JXKNMVRPLQDTJG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|