C8H15NOS2 — CID 103073381
2-[(1-oxo-1,4-thiazinan-4-yl)methyl]prop-2-ene-1-thiol (PubChem CID 103073381) has the molecular formula C8H15NOS2 and a molecular weight of 205.35 g/mol. Its IUPAC name is 2-[(1-oxo-1,4-thiazinan-4-yl)methyl]prop-2-ene-1-thiol.
| Compound Name | 2-[(1-oxo-1,4-thiazinan-4-yl)methyl]prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 103073381 |
| Molecular Formula | C8H15NOS2 |
| Molecular Weight | 205.35 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 2-[(1-oxo-1,4-thiazinan-4-yl)methyl]prop-2-ene-1-thiol |
| SMILES | C=C(CS)CN1CCS(=O)CC1 |
| InChI | InChI=1S/C8H15NOS2/c1-8(7-11)6-9-2-4-12(10)5-3-9/h11H,1-7H2 |
| InChIKey | BJSXCNBVZMZMGX-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.35 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|