C10H15NO2S — CID 103073949
1-[2-(sulfanylmethyl)prop-2-enyl]azepane-2,7-dione (PubChem CID 103073949) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is 1-[2-(sulfanylmethyl)prop-2-enyl]azepane-2,7-dione.
| Compound Name | 1-[2-(sulfanylmethyl)prop-2-enyl]azepane-2,7-dione |
|---|---|
| PubChem CID | 103073949 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 1-[2-(sulfanylmethyl)prop-2-enyl]azepane-2,7-dione |
| SMILES | C=C(CS)CN1C(=O)CCCCC1=O |
| InChI | InChI=1S/C10H15NO2S/c1-8(7-14)6-11-9(12)4-2-3-5-10(11)13/h14H,1-7H2 |
| InChIKey | QGUXRLKZRYCETI-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|