C8H12N2O2S — CID 103072934
3-[2-(aminomethyl)prop-2-enyl]-1,3-thiazinane-2,4-dione (PubChem CID 103072934) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is 3-[2-(aminomethyl)prop-2-enyl]-1,3-thiazinane-2,4-dione.
| Compound Name | 3-[2-(aminomethyl)prop-2-enyl]-1,3-thiazinane-2,4-dione |
|---|---|
| PubChem CID | 103072934 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 3-[2-(aminomethyl)prop-2-enyl]-1,3-thiazinane-2,4-dione |
| SMILES | C=C(CN)CN1C(=O)CCSC1=O |
| InChI | InChI=1S/C8H12N2O2S/c1-6(4-9)5-10-7(11)2-3-13-8(10)12/h1-5,9H2 |
| InChIKey | TXZSXRHIEIJGRQ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|