About 2-(4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetohydrazide
2-(4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetohydrazide (PubChem CID 23057172) has the molecular formula C11H13N3O2S
and a molecular weight of 251.31 g/mol. Its IUPAC name is 2-(4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetohydrazide.
Molecular Properties
| Compound Name | 2-(4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetohydrazide |
| PubChem CID | 23057172 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 2-(4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetohydrazide |
| SMILES | NNC(=O)CN1C(=O)CCSc2ccccc21 |
| InChI | InChI=1S/C11H13N3O2S/c12-13-10(15)7-14-8-3-1-2-4-9(8)17-6-5-11(14)16/h1-4H,5-7,12H2,(H,13,15) |
| InChIKey | RQFFLMFMUIEUNN-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetohydrazide?
The IUPAC name of 2-(4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetohydrazide (CID 23057172) is 2-(4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetohydrazide.
What is the SMILES notation for 2-(4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetohydrazide?
The canonical SMILES for 2-(4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetohydrazide is NNC(=O)CN1C(=O)CCSc2ccccc21.
What is the InChIKey of 2-(4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetohydrazide?
The InChIKey is RQFFLMFMUIEUNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O2S/c12-13-10(15)7-14-8-3-1-2-4-9(8)17-6-5-11(14)16/h1-4H,5-7,12H2,(H,13,15).
What are the key properties of 2-(4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetohydrazide?
2-(4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetohydrazide has a molecular weight of 251.31 g/mol, XLogP of 0.51, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetohydrazide is sourced from PubChem (CID 23057172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).