C12H15NO2S — CID 84617915
5-(3-hydroxypropyl)-2,3-dihydro-1,5-benzothiazepin-4-one (PubChem CID 84617915) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is 5-(3-hydroxypropyl)-2,3-dihydro-1,5-benzothiazepin-4-one.
| Compound Name | 5-(3-hydroxypropyl)-2,3-dihydro-1,5-benzothiazepin-4-one |
|---|---|
| PubChem CID | 84617915 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 5-(3-hydroxypropyl)-2,3-dihydro-1,5-benzothiazepin-4-one |
| SMILES | O=C1CCSc2ccccc2N1CCCO |
| InChI | InChI=1S/C12H15NO2S/c14-8-3-7-13-10-4-1-2-5-11(10)16-9-6-12(13)15/h1-2,4-5,14H,3,6-9H2 |
| InChIKey | ZARCCODJVGJOGC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |