C12H11NO2S — CID 166631783
5-prop-2-enoyl-2,3-dihydro-1,5-benzothiazepin-4-one (PubChem CID 166631783) has the molecular formula C12H11NO2S and a molecular weight of 233.29 g/mol. Its IUPAC name is 5-prop-2-enoyl-2,3-dihydro-1,5-benzothiazepin-4-one.
| Compound Name | 5-prop-2-enoyl-2,3-dihydro-1,5-benzothiazepin-4-one |
|---|---|
| PubChem CID | 166631783 |
| Molecular Formula | C12H11NO2S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 5-prop-2-enoyl-2,3-dihydro-1,5-benzothiazepin-4-one |
| SMILES | C=CC(=O)N1C(=O)CCSc2ccccc21 |
| InChI | InChI=1S/C12H11NO2S/c1-2-11(14)13-9-5-3-4-6-10(9)16-8-7-12(13)15/h2-6H,1,7-8H2 |
| InChIKey | XRYOWAJCHNUZCO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|