C15H16N4O2S3 — CID 43953612
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetamide (PubChem CID 43953612) has the molecular formula C15H16N4O2S3 and a molecular weight of 380.52 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetamide |
|---|---|
| PubChem CID | 43953612 |
| Molecular Formula | C15H16N4O2S3 |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetamide |
| SMILES | CCSc1nnc(NC(=O)CN2C(=O)CCSc3ccccc32)s1 |
| InChI | InChI=1S/C15H16N4O2S3/c1-2-22-15-18-17-14(24-15)16-12(20)9-19-10-5-3-4-6-11(10)23-8-7-13(19)21/h3-6H,2,7-9H2,1H3,(H,16,17,20) |
| InChIKey | JAEVPFLYSMTEPU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|