C17H19N5O3S2 — CID 9045652
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(4S)-4-methyl-3-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 9045652) has the molecular formula C17H19N5O3S2 and a molecular weight of 405.51 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(4S)-4-methyl-3-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(4S)-4-methyl-3-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 9045652 |
| Molecular Formula | C17H19N5O3S2 |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(4S)-4-methyl-3-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CCSc1nnc(NC(=O)CN2C(=O)[C@H](C)N(c3ccc(C)cc3)C2=O)s1 |
| InChI | InChI=1S/C17H19N5O3S2/c1-4-26-16-20-19-15(27-16)18-13(23)9-21-14(24)11(3)22(17(21)25)12-7-5-10(2)6-8-12/h5-8,11H,4,9H2,1-3H3,(H,18,19,23)/t11-/m0/s1 |
| InChIKey | OLQFQNVVMXBTFR-NSHDSACASA-N |
| XLogP | 2.75 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|