C21H20N4O2S3 — CID 16562980
N-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(3-oxo-1,4-benzothiazin-4-yl)propanamide (PubChem CID 16562980) has the molecular formula C21H20N4O2S3 and a molecular weight of 456.62 g/mol. Its IUPAC name is N-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(3-oxo-1,4-benzothiazin-4-yl)propanamide.
| Compound Name | N-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(3-oxo-1,4-benzothiazin-4-yl)propanamide |
|---|---|
| PubChem CID | 16562980 |
| Molecular Formula | C21H20N4O2S3 |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | N-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(3-oxo-1,4-benzothiazin-4-yl)propanamide |
| SMILES | Cc1ccc(CSc2nnc(NC(=O)CCN3C(=O)CSc4ccccc43)s2)cc1 |
| InChI | InChI=1S/C21H20N4O2S3/c1-14-6-8-15(9-7-14)12-29-21-24-23-20(30-21)22-18(26)10-11-25-16-4-2-3-5-17(16)28-13-19(25)27/h2-9H,10-13H2,1H3,(H,22,23,26) |
| InChIKey | VEQPSJRQEQPEGU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|