C22H27N3OS2 — CID 7921691
2-(1-adamantyl)-N-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 7921691) has the molecular formula C22H27N3OS2 and a molecular weight of 413.61 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 7921691 |
| Molecular Formula | C22H27N3OS2 |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 2-(1-adamantyl)-N-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | Cc1ccc(CSc2nnc(NC(=O)CC34CC5CC(CC(C5)C3)C4)s2)cc1 |
| InChI | InChI=1S/C22H27N3OS2/c1-14-2-4-15(5-3-14)13-27-21-25-24-20(28-21)23-19(26)12-22-9-16-6-17(10-22)8-18(7-16)11-22/h2-5,16-18H,6-13H2,1H3,(H,23,24,26) |
| InChIKey | PAFGGSDCZKTILD-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|