C21H23BrClN3OS2 — CID 98625915
2-[(5S,7S)-3-bromo-1-adamantyl]-N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 98625915) has the molecular formula C21H23BrClN3OS2 and a molecular weight of 512.93 g/mol. Its IUPAC name is 2-[(5S,7S)-3-bromo-1-adamantyl]-N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-[(5S,7S)-3-bromo-1-adamantyl]-N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 98625915 |
| Molecular Formula | C21H23BrClN3OS2 |
| Molecular Weight | 512.93 g/mol |
| Exact Mass | 511.02 |
| IUPAC Name | 2-[(5S,7S)-3-bromo-1-adamantyl]-N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | O=C(CC12C[C@@H]3C[C@H](CC(Br)(C3)C1)C2)Nc1nnc(SCc2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C21H23BrClN3OS2/c22-21-8-14-5-15(9-21)7-20(6-14,12-21)10-17(27)24-18-25-26-19(29-18)28-11-13-1-3-16(23)4-2-13/h1-4,14-15H,5-12H2,(H,24,25,27)/t14-,15-,20?,21?/m0/s1 |
| InChIKey | ILXBAORJXWVPAP-LDSOLPTJSA-N |
| XLogP | 6.55 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.93 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|