C22H22N4O3S3 — CID 43953666
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl]acetamide (PubChem CID 43953666) has the molecular formula C22H22N4O3S3 and a molecular weight of 486.64 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl]acetamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl]acetamide |
|---|---|
| PubChem CID | 43953666 |
| Molecular Formula | C22H22N4O3S3 |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl]acetamide |
| SMILES | CCSc1nnc(NC(=O)CN2C(=O)CC(c3ccc(OC)cc3)Sc3ccccc32)s1 |
| InChI | InChI=1S/C22H22N4O3S3/c1-3-30-22-25-24-21(32-22)23-19(27)13-26-16-6-4-5-7-17(16)31-18(12-20(26)28)14-8-10-15(29-2)11-9-14/h4-11,18H,3,12-13H2,1-2H3,(H,23,24,27) |
| InChIKey | ZGTBOFKPTALJRB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|