C9H11NO4S — CID 131418976
(E)-4-(2,4-dioxo-1,3-thiazinan-3-yl)-2-methylbut-2-enoic acid (PubChem CID 131418976) has the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. Its IUPAC name is (E)-4-(2,4-dioxo-1,3-thiazinan-3-yl)-2-methylbut-2-enoic acid.
| Compound Name | (E)-4-(2,4-dioxo-1,3-thiazinan-3-yl)-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 131418976 |
| Molecular Formula | C9H11NO4S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | (E)-4-(2,4-dioxo-1,3-thiazinan-3-yl)-2-methylbut-2-enoic acid |
| SMILES | C/C(=C\CN1C(=O)CCSC1=O)C(=O)O |
| InChI | InChI=1S/C9H11NO4S/c1-6(8(12)13)2-4-10-7(11)3-5-15-9(10)14/h2H,3-5H2,1H3,(H,12,13)/b6-2+ |
| InChIKey | KHATXWKLYNWBQH-QHHAFSJGSA-N |
| XLogP | 1.10 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|