About 4-(2,4-dioxo-1,3-thiazolidin-3-yl)-3-methylbut-2-enoic acid
4-(2,4-dioxo-1,3-thiazolidin-3-yl)-3-methylbut-2-enoic acid (PubChem CID 76975008) has the molecular formula C8H9NO4S
and a molecular weight of 215.23 g/mol. Its IUPAC name is 4-(2,4-dioxo-1,3-thiazolidin-3-yl)-3-methylbut-2-enoic acid.
Molecular Properties
| Compound Name | 4-(2,4-dioxo-1,3-thiazolidin-3-yl)-3-methylbut-2-enoic acid |
| PubChem CID | 76975008 |
| Molecular Formula | C8H9NO4S |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | 4-(2,4-dioxo-1,3-thiazolidin-3-yl)-3-methylbut-2-enoic acid |
| SMILES | CC(=CC(=O)O)CN1C(=O)CSC1=O |
| InChI | InChI=1S/C8H9NO4S/c1-5(2-7(11)12)3-9-6(10)4-14-8(9)13/h2H,3-4H2,1H3,(H,11,12) |
| InChIKey | XJAAGZMYBGUFGQ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,4-dioxo-1,3-thiazolidin-3-yl)-3-methylbut-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-dioxo-1,3-thiazolidin-3-yl)-3-methylbut-2-enoic acid?
The IUPAC name of 4-(2,4-dioxo-1,3-thiazolidin-3-yl)-3-methylbut-2-enoic acid (CID 76975008) is 4-(2,4-dioxo-1,3-thiazolidin-3-yl)-3-methylbut-2-enoic acid.
What is the SMILES notation for 4-(2,4-dioxo-1,3-thiazolidin-3-yl)-3-methylbut-2-enoic acid?
The canonical SMILES for 4-(2,4-dioxo-1,3-thiazolidin-3-yl)-3-methylbut-2-enoic acid is CC(=CC(=O)O)CN1C(=O)CSC1=O.
What is the InChIKey of 4-(2,4-dioxo-1,3-thiazolidin-3-yl)-3-methylbut-2-enoic acid?
The InChIKey is XJAAGZMYBGUFGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO4S/c1-5(2-7(11)12)3-9-6(10)4-14-8(9)13/h2H,3-4H2,1H3,(H,11,12).
What are the key properties of 4-(2,4-dioxo-1,3-thiazolidin-3-yl)-3-methylbut-2-enoic acid?
4-(2,4-dioxo-1,3-thiazolidin-3-yl)-3-methylbut-2-enoic acid has a molecular weight of 215.23 g/mol, XLogP of 0.71, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dioxo-1,3-thiazolidin-3-yl)-3-methylbut-2-enoic acid is sourced from PubChem (CID 76975008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).