C10H9NO4S2 — CID 80731237
4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]-5-methylthiophene-2-carboxylic acid (PubChem CID 80731237) has the molecular formula C10H9NO4S2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]-5-methylthiophene-2-carboxylic acid.
| Compound Name | 4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]-5-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 80731237 |
| Molecular Formula | C10H9NO4S2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]-5-methylthiophene-2-carboxylic acid |
| SMILES | Cc1sc(C(=O)O)cc1CN1C(=O)CSC1=O |
| InChI | InChI=1S/C10H9NO4S2/c1-5-6(2-7(17-5)9(13)14)3-11-8(12)4-16-10(11)15/h2H,3-4H2,1H3,(H,13,14) |
| InChIKey | DWUGGXXSAFIAFH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|