About 5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid
5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid (PubChem CID 83290505) has the molecular formula C10H13NO2S
and a molecular weight of 211.29 g/mol. Its IUPAC name is 5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid.
Analyze 5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid?
The IUPAC name of 5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid (CID 83290505) is 5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid.
What is the SMILES notation for 5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid?
The canonical SMILES for 5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid is CC(C)N1Cc2cc(C(=O)O)sc2C1.
What is the InChIKey of 5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid?
The InChIKey is BEGYOGVGUZNINM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2S/c1-6(2)11-4-7-3-8(10(12)13)14-9(7)5-11/h3,6H,4-5H2,1-2H3,(H,12,13).
What are the key properties of 5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid?
5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid has a molecular weight of 211.29 g/mol, XLogP of 2.17, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid is sourced from PubChem (CID 83290505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).