5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid

C10H13NO2S — CID 83290505

IUPAC5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid
SMILESCC(C)N1Cc2cc(C(=O)O)sc2C1
InChIInChI=1S/C10H13NO2S/c1-6(2)11-4-7-3-8(10(12)13)14-9(7)5-11/h3,6H,4-5H2,1-2H3,(H,12,13)
InChIKeyBEGYOGVGUZNINM-UHFFFAOYSA-N
MW211.29 g/mol
LogP2.17
Rot. Bonds2

About 5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid

5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid (PubChem CID 83290505) has the molecular formula C10H13NO2S and a molecular weight of 211.29 g/mol. Its IUPAC name is 5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid.

Molecular Properties

Compound Name5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid
PubChem CID83290505
Molecular FormulaC10H13NO2S
Molecular Weight211.29 g/mol
Exact Mass211.07
IUPAC Name5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid
SMILESCC(C)N1Cc2cc(C(=O)O)sc2C1
InChIInChI=1S/C10H13NO2S/c1-6(2)11-4-7-3-8(10(12)13)14-9(7)5-11/h3,6H,4-5H2,1-2H3,(H,12,13)
InChIKeyBEGYOGVGUZNINM-UHFFFAOYSA-N
XLogP2.17
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500211.29
LogP ≤ 52.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid?
The IUPAC name of 5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid (CID 83290505) is 5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid.
What is the SMILES notation for 5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid?
The canonical SMILES for 5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid is CC(C)N1Cc2cc(C(=O)O)sc2C1.
What is the InChIKey of 5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid?
The InChIKey is BEGYOGVGUZNINM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2S/c1-6(2)11-4-7-3-8(10(12)13)14-9(7)5-11/h3,6H,4-5H2,1-2H3,(H,12,13).
What are the key properties of 5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid?
5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid has a molecular weight of 211.29 g/mol, XLogP of 2.17, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid is sourced from PubChem (CID 83290505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).