C10H15N3O3S — CID 89470156
2-(2,4-dioxo-1,3-thiazolidin-3-yl)-N-[(1-methylazetidin-3-yl)methyl]acetamide (PubChem CID 89470156) has the molecular formula C10H15N3O3S and a molecular weight of 257.31 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-thiazolidin-3-yl)-N-[(1-methylazetidin-3-yl)methyl]acetamide.
| Compound Name | 2-(2,4-dioxo-1,3-thiazolidin-3-yl)-N-[(1-methylazetidin-3-yl)methyl]acetamide |
|---|---|
| PubChem CID | 89470156 |
| Molecular Formula | C10H15N3O3S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 2-(2,4-dioxo-1,3-thiazolidin-3-yl)-N-[(1-methylazetidin-3-yl)methyl]acetamide |
| SMILES | CN1CC(CNC(=O)CN2C(=O)CSC2=O)C1 |
| InChI | InChI=1S/C10H15N3O3S/c1-12-3-7(4-12)2-11-8(14)5-13-9(15)6-17-10(13)16/h7H,2-6H2,1H3,(H,11,14) |
| InChIKey | OZNXZQCSLHQGSI-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|