C8H8N2O2S — CID 55221144
(2Z)-2-[4-oxo-3-(2-oxopropyl)-1,3-thiazolidin-2-ylidene]acetonitrile (PubChem CID 55221144) has the molecular formula C8H8N2O2S and a molecular weight of 196.23 g/mol. Its IUPAC name is (2Z)-2-[4-oxo-3-(2-oxopropyl)-1,3-thiazolidin-2-ylidene]acetonitrile.
| Compound Name | (2Z)-2-[4-oxo-3-(2-oxopropyl)-1,3-thiazolidin-2-ylidene]acetonitrile |
|---|---|
| PubChem CID | 55221144 |
| Molecular Formula | C8H8N2O2S |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | (2Z)-2-[4-oxo-3-(2-oxopropyl)-1,3-thiazolidin-2-ylidene]acetonitrile |
| SMILES | CC(=O)CN1C(=O)CS/C1=C\C#N |
| InChI | InChI=1S/C8H8N2O2S/c1-6(11)4-10-7(12)5-13-8(10)2-3-9/h2H,4-5H2,1H3/b8-2- |
| InChIKey | XDBLIYRLSJCHKO-WAPJZHGLSA-N |
| XLogP | 0.52 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|