C21H30N2O3S — CID 7667991
N-(1-adamantyl)-2-[(2Z)-2-(3,3-dimethyl-2-oxobutylidene)-4-oxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 7667991) has the molecular formula C21H30N2O3S and a molecular weight of 390.55 g/mol. Its IUPAC name is N-(1-adamantyl)-2-[(2Z)-2-(3,3-dimethyl-2-oxobutylidene)-4-oxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(1-adamantyl)-2-[(2Z)-2-(3,3-dimethyl-2-oxobutylidene)-4-oxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 7667991 |
| Molecular Formula | C21H30N2O3S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | N-(1-adamantyl)-2-[(2Z)-2-(3,3-dimethyl-2-oxobutylidene)-4-oxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | CC(C)(C)C(=O)/C=C1\SCC(=O)N1CC(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H30N2O3S/c1-20(2,3)16(24)7-19-23(18(26)12-27-19)11-17(25)22-21-8-13-4-14(9-21)6-15(5-13)10-21/h7,13-15H,4-6,8-12H2,1-3H3,(H,22,25)/b19-7- |
| InChIKey | NBCWSULGBBOSPM-GXHLCREISA-N |
| XLogP | 3.10 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|