C18H25N3O3 — CID 42923571
N-(1-adamantyl)-2-(1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)acetamide (PubChem CID 42923571) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is N-(1-adamantyl)-2-(1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)acetamide.
| Compound Name | N-(1-adamantyl)-2-(1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)acetamide |
|---|---|
| PubChem CID | 42923571 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | N-(1-adamantyl)-2-(1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)acetamide |
| SMILES | O=C(CN1C(=O)C2CCCN2C1=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H25N3O3/c22-15(10-21-16(23)14-2-1-3-20(14)17(21)24)19-18-7-11-4-12(8-18)6-13(5-11)9-18/h11-14H,1-10H2,(H,19,22) |
| InChIKey | CJXFTPDEXHNUHZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|