C19H31N3O5 — CID 171669478
N-(1-adamantyl)-2-(4-methylpiperazin-1-yl)acetamide;oxalic acid (PubChem CID 171669478) has the molecular formula C19H31N3O5 and a molecular weight of 381.47 g/mol. Its IUPAC name is N-(1-adamantyl)-2-(4-methylpiperazin-1-yl)acetamide;oxalic acid.
| Compound Name | N-(1-adamantyl)-2-(4-methylpiperazin-1-yl)acetamide;oxalic acid |
|---|---|
| PubChem CID | 171669478 |
| Molecular Formula | C19H31N3O5 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | N-(1-adamantyl)-2-(4-methylpiperazin-1-yl)acetamide;oxalic acid |
| SMILES | CN1CCN(CC(=O)NC23CC4CC(CC(C4)C2)C3)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H29N3O.C2H2O4/c1-19-2-4-20(5-3-19)12-16(21)18-17-9-13-6-14(10-17)8-15(7-13)11-17;3-1(4)2(5)6/h13-15H,2-12H2,1H3,(H,18,21);(H,3,4)(H,5,6) |
| InChIKey | RWKNYWCZBOECEP-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|