C19H26N2O2 — CID 108795070
N-(1-adamantyl)-2-(2,6-dimethyl-4-oxo-1-pyridinyl)acetamide (PubChem CID 108795070) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is N-(1-adamantyl)-2-(2,6-dimethyl-4-oxo-1-pyridinyl)acetamide.
| Compound Name | N-(1-adamantyl)-2-(2,6-dimethyl-4-oxo-1-pyridinyl)acetamide |
|---|---|
| PubChem CID | 108795070 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | N-(1-adamantyl)-2-(2,6-dimethyl-4-oxo-1-pyridinyl)acetamide |
| SMILES | Cc1cc(=O)cc(C)n1CC(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H26N2O2/c1-12-3-17(22)4-13(2)21(12)11-18(23)20-19-8-14-5-15(9-19)7-16(6-14)10-19/h3-4,14-16H,5-11H2,1-2H3,(H,20,23) |
| InChIKey | MSBKOTZRMMXLBL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |